China Cyfluthrin 1% + Triazophos 9% Ec Insecticide Pesticide & Acaricide Nematicide, Find details about China Veterinary Substance, Miticide from Cyfluthrin 1% + Triazophos 9% Ec Insecticide Pesticide & Acaricide Nematicide
| Isomerism | Chiral, existing as four diastereoisomer pairs (8 enantiomers) |
| Chemical formula | C22H18Cl2FNO3 |
| Canonical SMILES | CC1(C(C1C(=O)OC(C#N)C2=CC(=C(C=C2)F)OC3=CC=CC=C3)C=C(Cl)Cl)C |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | QQODLKZGRKWIFG-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C22H18Cl2FNO3/c1-22(2)15(11-19(23)24)20(22)21(27)29-18(12-26)13-8-9-16(25)17(10-13)28-14-6-4-3-5-7-14/h3-11,15,18,20H,1-2H3 |
| Pesticide type | Insecticide |
| Substance group | Pyrethroid |
| Minimum active substance purity | 920 +/- 25 g/kg |
| Known relevant impurities | EU dossier - Only 1% water declared |
| Substance origin | Synthetic |
| Mode of action | Non-systemic with contact and stomach action and rapid knock-down effect. Sodium channel modulator. |
| CAS RN | 68359-37-5 |
| EC number | 269-855-7 |
| CIPAC number | 385 |
| US EPA chemical code | 128831 |
| PubChem CID | 104926 |
| Molecular mass (g mol-1) | 434.29 |
| PIN (Preferred Identification Name) | (E)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1E,3E)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| IUPAC name | (RS)-α-cyano-4-fluoro-3-phenoxybenzyl (1RS,3RS;1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
| CAS name | cyano(4-fluoro-3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| Other status information | Chemical subject to PIC regulations |
| Relevant Environmental Water Quality Standards | UK Environment Agency non-statutory standard for the protection of freshwater and saltwater aquatic life 0.001 ug/L] |
| Isomerism | None |
| Chemical formula | C12H16N3O3PS |
| Canonical SMILES | CCOP(=S)(OCC)OC1=NN(C=N1)C2=CC=CC=C2 |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | AMFGTOFWMRQMEM-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C12H16N3O3PS/c1-3-16-19(20,17-4-2)18-12-13-10-15(14-12)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3 |
| Pesticide type | Insecticide, Acaricide, Nematicide |
| Substance group | Organophosphate |
| Minimum active substance purity | - |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Non-systemic, broad spectrum with contact and stomach action. Cholinesterase inhibitor. |
| CAS RN | 24017-47-8 |
| EC number | 245-986-5 |
| CIPAC number | 353 |
| US EPA chemical code | 344600 |
| PubChem CID | 32184 |
| Molecular mass (g mol-1) | 313.3 |
| PIN (Preferred Identification Name) | O,O-diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) phosphorothioate |
| IUPAC name | O,O-diethyl O-1-phenyl-1H-1,2,4-triazol-3-yl phosphorothioate |
| CAS name | O,O-diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) phosphorothioate |
| Other status information | Marine Pollutant; Chemical subject to PIC regulations |
| Relevant Environmental Water Quality Standards | UK statutory standard for the protection of aquatic life: annual mean conc for inland, coastal and territorial waters; 0.005 ug/L |