China Triazophos of Insecticides Pesticide (200g/l EC, 400g/l EC), Find details about China Acaricide, Nematicide from Triazophos of Insecticides Pesticide (200g/l EC, 400g/l EC)
| Isomerism | None |
| Chemical formula | C12H16N3O3PS |
| Canonical SMILES | CCOP(=S)(OCC)OC1=NN(C=N1)C2=CC=CC=C2 |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | AMFGTOFWMRQMEM-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C12H16N3O3PS/c1-3-16-19(20,17-4-2)18-12-13-10-15(14-12)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3 |
| Pesticide type | Insecticide, Acaricide, Nematicide |
| Substance group | Organophosphate |
| Minimum active substance purity | - |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Non-systemic, broad spectrum with contact and stomach action. Cholinesterase inhibitor. |
| CAS RN | 24017-47-8 |
| EC number | 245-986-5 |
| CIPAC number | 353 |
| US EPA chemical code | 344600 |
| PubChem CID | 32184 |
| Molecular mass (g mol-1) | 313.3 |
| PIN (Preferred Identification Name) | O,O-diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) phosphorothioate |
| IUPAC name | O,O-diethyl O-1-phenyl-1H-1,2,4-triazol-3-yl phosphorothioate |
| CAS name | O,O-diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) phosphorothioate |
| Other status information | Marine Pollutant; Chemical subject to PIC regulations |
| Relevant Environmental Water Quality Standards | UK statutory standard for the protection of aquatic life: annual mean conc for inland, coastal and territorial waters; 0.005 ug/L |