China Pirimiphos-Methyl of Insecticide Pesticide (250g/l EC, 300g/l EC, 500g/l EC), Find details about China Acaricide, Profenofos from Pirimiphos-Methyl of Insecticide Pesticide (250g/l EC, 300g/l EC, 500g/l EC)
| Isomerism | - |
| Chemical formula | C11H20N3O3PS |
| Canonical SMILES | CCN(CC)C1=NC(=CC(=N1)OP(=S)(OC)OC)C |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | QHOQHJPRIBSPCY-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C11H20N3O3PS/c1-6-14(7-2)11-12-9(3)8-10(13-11)17-18(19,15-4)16-5/h8H,6-7H2,1-5H3 |
| Pesticide type | Insecticide, Acaricide |
| Substance group | Organophosphate |
| Minimum active substance purity | 880 g/kg |
| Known relevant impurities | EU dossier - various metabolites |
| Substance origin | Synthetic |
| Mode of action | Broad-spectrum with contact and respiratory action. Acetylcholinesterase (AChE) inhibitor. |
| CAS RN | 29232-93-7 |
| EC number | 249-528-5 |
| CIPAC number | 239 |
| US EPA chemical code | 108102 |
| PubChem CID | 34526 |
| Molecular mass (g mol-1) | 305.33 |
| PIN (Preferred Identification Name) | - |
| IUPAC name | O-2-diethylamino-6-methylpyrimidin-4-yl O,O-dimethyl phosphorothioate |
| CAS name | O-(2-(diethylamino)-6-methyl-4-pyrimidinyl) O,O-dimethyl phosphorothioate |
| Other status information | PAN listed Highly Hazardous Chemical |
| Relevant Environmental Water Quality Standards | UK non-statutory standard for the protection of aquatic life: freshwater and saltwater annual average; 0.015 ug/L; max acceptable conc: 0.05 ug/L |