China Herbicide Pesticide Fenoxaprop-P-Ethyl 5% + Ethoxysulfuron 15% Wg/Wdg, Find details about China Glyphosate, Weedicide from Herbicide Pesticide Fenoxaprop-P-Ethyl 5% + Ethoxysulfuron 15% Wg/Wdg
| Isomerism | - |
| Chemical formula | C15H18N4O7S |
| Canonical SMILES | CCOC1=CC=CC=C1OS(=O)(=O)NC(=O)NC2=NC(=CC(=N2)OC)OC |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | UWVKRNOCDUPIDM-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C15H18N4O7S/c1-4-25-10-7-5-6-8-11(10)26-27(21,22)19-15(20)18-14-16-12(23-2)9-13(17-14)24-3/h5-9H,4H2,1-3H3,(H2,16,17,18,19,20)/f/h18-19H |
| Pesticide type | Herbicide |
| Substance group | Sulfonylurea |
| Minimum active substance purity | 950 g/kg |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Selective, inhibits plant cell growth. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
| CAS RN | 126801-58-9 |
| EC number | - |
| CIPAC number | 591 |
| US EPA chemical code | - |
| PubChem CID | 3623881 |
| Molecular mass (g mol-1) | 398.39 |
| PIN (Preferred Identification Name) | 2-ethoxyphenyl [(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamate |
| IUPAC name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethoxyphenoxysulfonyl)urea |
| CAS name | 2-ethoxyphenyl [[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]sulfamate |
| Other status information | Chemical subject to PIC regulations |
| Isomerism | Fenoxaprop is a chiral molecule existing in the R- and S-forms. Fenoxaprop-P is the R-isomer. |
| Chemical formula | C18H16ClNO5 |
| Canonical SMILES | CCOC(=O)C(C)OC1=CC=C(C=C1)OC2=NC3=C(O2)C=C(C=C3)Cl |
| Isomeric SMILES | CCOC(=O)[C@@H](C)OC1=CC=C(C=C1)OC2=NC3=C(O2)C=C(C=C3)Cl |
| International Chemical Identifier key (InChIKey) | PQKBPHSEKWERTG-LLVKDONJSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C18H16ClNO5/c1-3-22-17(21)11(2)23-13-5-7-14(8-6-13)24-18-20-15-9-4-12(19)10-16(15)25-18/h4-11H,3H2,1-2H3/t11-/m1/s1 |
| Pesticide type | Herbicide |
| Substance group | Aryloxyphenoxypropionate |
| Minimum active substance purity | 920 g/kg |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Selective, systemic with contact action. Inhibits fatty acid synthesis (ACCase). |
| CAS RN | 71283-80-2 |
| EC number | - |
| CIPAC number | 484 |
| US EPA chemical code | - |
| PubChem CID | 91707 |
| Molecular mass (g mol-1) | 361.78 |
| PIN (Preferred Identification Name) | ethyl (2R)-2-{4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy}propanoate |
| IUPAC name | (R)-2[4-[(6-chloro-2-benzoxazolyl)oxy]-phenoxy]-propanoic acid |
| CAS name | (R)-2-(4-((6-chloro-1,3-benzoxazolyl)oxy)phenoxy)propanoate ethyl |