China Butyl Acetate CAS 123-86-4 Price, Find details about China Butyl Acetate, CAS123-86-4 from Butyl Acetate CAS 123-86-4 Price
Product Name: | n-butyl acetate / butyl acetate / BAC |
Other name: | n-butyl ester, Butile |
Appearance: | Colorless Transparent Liquid |
CAS NO.: | 123-86-4 |
UN NO.: | 1123 |
Molecular Formula: | C6H12O2 |
Molecular Weight: | 116.16 g·mol−1 |
InChI: | InChI=1S/C6H12O2/c1-3-4-5-8-6(2)7/h3-5H2,1-2H3 Yes |
Melting point: | −78 °C (−108 °F; 195 K) |
Boiling point: | 126.1 °C (259.0 °F; 399.2 K) |
Water solubility: | 0.68 g/100 mL (20 °C) |
Refractive index: | 1.3941 (20 °C) |
Application: | 1. used as solvent in coating industry. 2. used as solvent in printing ink,adhesive agent. 3. used as the reaction intermediate in the production of resin. 4. used as a cleaning agent. 5. used as a component in diluents. |
Specfication of butyl acetate | ||
Inspection Item | Measurement Units | Qualified Result |
Appearance | transparent liquid | |
Flavor | odorless | |
Chroma | ≤ | 10 |
density,g/cm3 | 0.878-0.883 | |
Purity(%) | ≥ | 99.0 |
Water content(%) | ≤ | 0.20 |
Acidity(as acetic acid)(%) | ≤ | 0.010 |
Packaging of butyl acetate | |
170kg in per drum 1.galvanized steel drum 2.Bule painted steel drum 3.or as you required | |