China Fungicide Pesticide & Metabolite Triadimefon 25% Wp, Find details about China Chlorothalonil, Dimethomorph from Fungicide Pesticide & Metabolite Triadimefon 25% Wp
| Isomerism | A chiral molecule with one chiral centre. There is little notable difference in the biological activities of the different enantiomeric forms |
| Chemical formula | C14H16ClN3O2 |
| Canonical SMILES | CC(C)(C)C(=O)C(N1C=NC=N1)OC2=CC=C(C=C2)Cl |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | WURBVZBTWMNKQT-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C14H16ClN3O2/c1-14(2,3)12(19)13(18-9-16-8-17-18)20-11-6-4-10(15)5-7-11/h4-9,13H,1-3H3 |
| Pesticide type | Fungicide, Metabolite |
| Metabolite Type | Soil |
| Substance group | Triazole |
| Minimum active substance purity | - |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Systemic with protective, curative and eradicant action. Disrupts membrane function. Sterol biosynthesis inhibitor. |
| CAS RN | 43121-43-3 |
| EC number | 256-103-8 |
| CIPAC number | 352 |
| US EPA chemical code | 109901 |
| PubChem CID | 39385 |
| Molecular mass (g mol-1) | 293.8 |
| PIN (Preferred Identification Name) | rac-(1R)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-one |
| IUPAC name | (RS)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-one |
| CAS name | 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)-2-butanone |