China Pyrazosulfuron-Ethyl of Herbicide Pesticide (10% WP, 25% WP), Find details about China Weedicide, Pretilachlor from Pyrazosulfuron-Ethyl of Herbicide Pesticide (10% WP, 25% WP)
| Isomerism | - |
| Chemical formula | C14H18N6O7S |
| Canonical SMILES | CCOC(=O)C1=C(N(N=C1)C)S(=O)(=O)NC(=O)NC2=NC(=CC(=N2)OC)OC |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | BGNQYGRXEXDAIQ-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C14H18N6O7S/c1-5-27-12(21)8-7-15-20(2)11(8)28(23,24)19-14(22)18-13-16-9(25-3)6-10(17-13)26-4/h6-7H,5H2,1-4H3,(H2,16,17,18,19,22) |
| Pesticide type | Herbicide |
| Substance group | Sulfonylurea |
| Minimum active substance purity | - |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Broad-spectrum activity, absorbed by roots and translocated through out plant by controlling the synthesis of amino acids. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
| CAS RN | 93697-74-6 |
| EC number | - |
| CIPAC number | None allocated |
| US EPA chemical code | - |
| PubChem CID | 91750 |
| Molecular mass (g mol-1) | 414.29 |
| PIN (Preferred Identification Name) | ethyl 5-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-1-methyl-1H-pyrazole-4-carboxylate |
| IUPAC name | ethyl 5-[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-1-methylpyrazole-4-carboxylate |
| CAS name | ethyl 5-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-1-methyl-1H-pyrazole-4-carboxylate |