China Herbicide Pesticide Fluazifop-P-Butyl 150g/L Ec, Find details about China Glyphosate, Weedicide from Herbicide Pesticide Fluazifop-P-Butyl 150g/L Ec
Isomerism | Fluazifop-P-butyl is the stereospecific R-isomer of the chiral herbicide fluazifop-butyl |
Chemical formula | C19H20F3NO4 |
Canonical SMILES | CCCCOC(=O)C(C)OC1=CC=C(C=C1)OC2=NC=C(C=C2)C(F)(F)F |
Isomeric SMILES | CCCCOC(=O)[C@@H](C)OC1=CC=C(C=C1)OC2=NC=C(C=C2)C(F)(F)F |
International Chemical Identifier key (InChIKey) | VAIZTNZGPYBOGF-CYBMUJFWSA-N |
International Chemical Identifier (InChI) | InChI=1S/C19H20F3NO4/c1-3-4-11-25-18(24)13(2)26-15-6-8-16(9-7-15)27-17-10-5-14(12-23-17)19(20,21)22/h5-10,12-13H,3-4,11H2,1-2H3/t13-/m1/s1 |
Pesticide type | Herbicide |
Substance group | Aryloxyphenoxypropionate |
Minimum active substance purity | 900 g/kg |
Known relevant impurities | EU dossier - 2-chloro-5-(trifluoromethyl)pyridine <1.5g/kg |
Substance origin | Synthetic |
Mode of action | Selective, absorbed through leaf surface. An acetyl CoA carboxylase inhibitor (ACCase). |
CAS RN | 79241-46-6 |
EC number | 274-125-6 |
CIPAC number | 467.205 |
US EPA chemical code | 122809 |
PubChem CID | 3033674 |
Molecular mass (g mol-1) | 383.36 |
PIN (Preferred Identification Name) | butyl (2R)-2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate |
IUPAC name | butyl (R)-2-{4-[5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionate |
CAS name | butyl (2R)-2-(4-((5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy)propanoate |