Ametryn 500g/l SC of Herbicide PesticideAmetyn is a triazine herbicide that no longer has EU regulatory approval for use. It is moderately soluble in water but much more so in organic solvents. It is quite volatile and not expected to leach to groundwater. It is moderately persistant in soils and can persist for a long time in water under certain conditions. It is moderately toxic to mammals and a recognised irritant. Ametryn is moderately toxic to most aquatic organisms, honey bees and earthworms but less so to birds.
Description: A triazine herbicide used to control most annual and broad-leaved weeds
Example pests controlled: Burmuda grass, wiregrass, goosegrass, crabgrass and other grass weeds; Broad-leaved weeds including dallisgrass, thistle, purslane, pigweed, cocklebur, lambsquarters, morning glory and foxtail
Example applications: Fruit including citrus, bananas; Corn; Potatoes; Sugarbeet
Chemical structure: | Isomerism | - |
| Chemical formula | C9H17N5S |
| Canonical SMILES | CCNC1=NC(=NC(=N1)SC)NC(C)C |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | RQVYBGPQFYCBGX-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C9H17N5S/c1-5-10-7-12-8(11-6(2)3)14-9(13-7)15-4/h6H,5H2,1-4H3,(H2,10,11,12,13,14) |
| Pesticide type | Herbicide |
| Substance group | Triazine |
| Minimum active substance purity | 96% |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Selective, systemic absorbed through foliage and roots. Inhibits photosynthesis (photosystem II). |
| CAS RN | 834-12-8 |
| EC number | 212-634-7 |
| CIPAC number | 133 |
| US EPA chemical code | 080801 |
| PubChem CID | 13263 |
| Molecular mass (g mol-1) | 227.12 |
| PIN (Preferred Identification Name) | N2-ethyl-6-(methylsulfanyl)-N4-(propan-2-yl)-1,3,5-triazine-2,4-diamine |
| IUPAC name | N2-ethyl-N4-isopropyl-6-methylthio-1,3,5-triazine-2,4-diamine |
| CAS name | N-ethyl-N'-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
| Other status information | Chemical subject to PIC regulations |