Fungicide Pesticide Trifloxystrobin 15% + Hexaconazole 30% WG/WDGTrifloxystrobinTrifloxystrobin is a widely used fungicide that has EU approval for use. It has a low aqueous solubility, a low volatility and, based on its chemical properties, would not normally be expected to leach to groundwater. It would not be expected to be persistent in soil or water systems. It has a low mammalian oral toxicity but there is some evidence that it may cause negative reproduction or fertility effects. It is highly toxic to bird, fish and aquatic invertebrates, but less toxic to honeybees and earthworms.
Description: A Strobilurin foliar applied fungicide for control of certain foliar, stem and root diseases
Example pests controlled: Alternaria; Black root; Black spot; Botrytis; Downy mildew; Powdery mildew; Leaf spot; Rust; Rhizoctonia stem & root rot; Scab; Blossom blight
Example applications: Cereals; Ornamentals; Vegetables including carrots, asparagus, curcubits, fruiting vegetables, root vegetables (except radish); Fruit including apples, pears, grapes, strawberries; Tropical crops
Chemical structure: | Isomerism | Exists as four geometric isomers: EE, EZ, ZE, and ZZ |
| Chemical formula | C20H19F3N2O4 |
| Canonical SMILES | CC(=NOCC1=CC=CC=C1C(=NOC)C(=O)OC)C2=CC(=CC=C2)C(F)(F)F |
| Isomeric SMILES | C/C(=N\OCC1=CC=CC=C1/C(=N\OC)/C(=O)OC)/C2=CC(=CC=C2)C(F)(F)F |
| International Chemical Identifier key (InChIKey) | ONCZDRURRATYFI-TVJDWZFNSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C20H19F3N2O4/c1-13(14-8-10-16(11-9-14)20(21,22)23)24-29-12-15-6-4-5-7-17(15)18(25-28-3)19(26)27-2/h4-11H,12H2,1-3H3/b24-13+,25-18+ |
| Pesticide type | Fungicide |
| Substance group | Strobilurin |
| Minimum active substance purity | 980 g/kg |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Broad spectrum with preventative and curative action. Respiration inhibitor (QoL fungicide). |
| CAS RN | 141517-21-7 |
| EC number | - |
| CIPAC number | 617 |
| US EPA chemical code | 129112 |
| PubChem CID | 11664966 |
| Molecular mass (g mol-1) | 408.37 |
| PIN (Preferred Identification Name) | methyl (2E)-(methoxyimino)(2-{[({(1E)-1-[3-(trifluoromethyl)phenyl]ethylidene}amino)oxy]methyl}phenyl)acetate |
| IUPAC name | methyl (E)-methoxyimino-{(E)-α-[1-(α,α,α-trifluoro-m-tolyl)ethylideneaminooxy]-o-tolyl}acetate |
| CAS name | methyl (αE)-α-(methoxyimino)-2-(((((1E)-1-(3-(trifluoromethyl)phenyl)ethylidene)amino)oxy)methyl)benzeneacetate |
Example pests controlled: Powdery mildew, Scabs, Rusts
Example applications: Vines; Apples; Pears,; Bananas; Vegetables; Some small grain cereals
Chemical structure: | Isomerism | A chiral molecule existing in the R- and S-forms. The R-enantiomer exhibts the greatest fungicial activity. |
| Chemical formula | C14H17Cl2N3O |
| Canonical SMILES | CCCCC(CN1C=NC=N1)(C2=C(C=C(C=C2)Cl)Cl)O |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | STMIIPIFODONDC-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C14H17Cl2N3O/c1-2-3-6-14(20,8-19-10-17-9-18-19)12-5-4-11(15)7-13(12)16/h4-5,7,9-10,20H,2-3,6,8H2,1H3 |
| Pesticide type | Fungicide, Other substance |
| Other constituent type | Wood preservative |
| Substance group | Triazole |
| Minimum active substance purity | - |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Broad spectrum, systemic with protective and curative action. Disrupts membrane function. Sterol biosynthesis inhibitor. |
| CAS RN | 79983-71-4 |
| EC number | 413-050-7 |
| CIPAC number | 465 |
| US EPA chemical code | 128925 |
| PubChem CID | 66461 |
| Molecular mass (g mol-1) | 314.21 |
| PIN (Preferred Identification Name) | - |
| IUPAC name | (RS)-2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol |
| CAS name | α-butyl-α-(2,4-dichlorophenyl)-1H-1,2,4-triazole-1-ethanol |