China Insecticide Pesticide Thiocyclam-Hydrogenoxalate 50% Sp, Find details about China Lufenuron, Imidacloprid from Insecticide Pesticide Thiocyclam-Hydrogenoxalate 50% Sp
| Isomerism | - |
| Chemical formula | C7H13NO4S3 |
| Canonical SMILES | CN(C)C1CSSSC1.C(=O)(C(=O)O)O |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | ICTQUFQQEYSGGJ-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C5H11NS3.C2H2O4/c1-6(2)5-3-7-9-8-4-5;3-1(4)2(5)6/h5H,3-4H2,1-2H3;(H,3,4)(H,5,6) |
| Pesticide type | Insecticide |
| Substance group | Unclassified |
| Minimum active substance purity | - |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | A nereistoxin analogue insecticide. Selective, stomach acting with some contact action. Nicotinic acetylcholine receptor agonist/anatagonist. |
| CAS RN | 31895-22-4 |
| EC number | 250-859-2 |
| CIPAC number | - |
| US EPA chemical code | 128868 |
| PubChem CID | 35969 |
| Molecular mass (g mol-1) | 271.37 |
| PIN (Preferred Identification Name) | - |
| IUPAC name | N,N-dimethyltrithian-5-amine;oxalic acid |
| CAS name | N,N-dimethyl-1,2,3-trithian-5-amine hydrogen oxalate |
| Other status information | Chemical subject to PIC regulations |