China Clethodim Ec Herbicide Pesticide (120g/l, 125g/l, 128g/l, 240g/l, 250g/l, 255g/l), Find details about China Weedicide, Hexazinone from Clethodim Ec Herbicide Pesticide (120g/l, 125g/l, 128g/l, 240g/l, 250g/l, 255g/l)
| Isomerism | A chiral molecule existing in the (E) and (Z) isomeric forms |
| Chemical formula | C17H26ClNO3S |
| Canonical SMILES | CCC(=C1C(=O)CC(CC1=O)CC(C)SCC)NOCC=CCl |
| Isomeric SMILES | CCC(=C1C(=O)CC(CC1=O)CC(C)SCC)NOC/C=C/Cl |
| International Chemical Identifier key (InChIKey) | SILSDTWXNBZOGF-JWGBMQLESA-N |
| International Chemical Identifier (InChI) | InChI=1S/C17H26ClNO3S/c1-4-14(19-22-8-6-7-18)17-15(20)10-13(11-16(17)21)9-12(3)23-5-2/h6-7,12-13,20H,4-5,8-11H2,1-3H3/b7-6?,19-14+ |
| Pesticide type | Herbicide |
| Substance group | Cyclohexanedione |
| Minimum active substance purity | >930 g/kg |
| Known relevant impurities | EU dossier - toluene < 4g/kg |
| Substance origin | Synthetic |
| Mode of action | Selective, systemic. An acetyl CoA carboxylase inhibitor (ACCase). |
| CAS RN | 99129-21-2 |
| EC number | - |
| CIPAC number | 508 |
| US EPA chemical code | 121011 |
| PubChem CID | 6444391 |
| Molecular mass (g mol-1) | 359.92 |
| PIN (Preferred Identification Name) | (5?)-2-[(1?)-N-{[(2E)-3-chloroprop-2-en-1-yl]oxy}propanimidoyl]-5-[(2?)-2-(ethylsulfanyl)propyl]-3-hydroxycyclohex-2-en-1-one |
| IUPAC name | (5RS)-2-{(E)-1-[(2E)-3-chloroallyloxyimino]propyl}-5-[(2RS)-2-(ethylthio)propyl]-3-hydroxycyclohex-2-en-1-one |
| CAS name | 2-[(1E)-1-[[[(2E)-3-chloro-2-propenyl]oxy]imino]propyl]-5-[2-(ethylthio)propyl]-3-hydroxy-2-cyclohexen-1-one |