China Dimethomorph + Propamocarb Fungicide Pesticide (250g/l + 250g/l SC, 300g/l + 300g/l SC), Find details about China Bactericide, Pyraclostrobin from Dimethomorph + Propamocarb Fungicide Pesticide (250g/l + 250g/l SC, 300g/l + 300g/l SC)
| Isomerism | Isomeric - a mixture of two isomers (E & Z) but only the Z-isomer has fungicidal activity |
| Chemical formula | C21H22ClNO4 |
| Canonical SMILES | COC1=C(C=C(C=C1)C(=CC(=O)N2CCOCC2)C3=CC=C(C=C3)Cl)OC |
| Isomeric SMILES | COC1=C(C=C(C=C1)/C(=C/C(=O)N2CCOCC2)/C3=CC=C(C=C3)Cl)OC |
| International Chemical Identifier key (InChIKey) | QNBTYORWCCMPQP-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C21H22ClNO4/c1-25-19-8-5-16(13-20(19)26-2)18(15-3-6-17(22)7-4-15)14-21(24)23-9-11-27-12-10-23/h3-8,13-14H,9-12H2,1-2H3/b18-14- |
| Pesticide type | Fungicide |
| Substance group | Morpholine |
| Minimum active substance purity | 965 g/kg (E/Z isomer ratio 44/56) |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Systemic with good protective activity. Cellulose synthesis inhibitor. |
| CAS RN | 110488-70-5 |
| EC number | 404-200-2 |
| CIPAC number | 483 |
| US EPA chemical code | 268800 |
| PubChem CID | 5889665 |
| Molecular mass (g mol-1) | 387.86 |
| PIN (Preferred Identification Name) | (2EZ)-3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(morpholin-4-yl)prop-2-en-1-one |
| IUPAC name | (EZ)-4-[3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)acryloyl]morpholine |
| CAS name | 4-(3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-oxo-2-propenyl)morpholine |
| Isomerism | - |
| Chemical formula | C9H20N2O2 |
| Canonical SMILES | CCCOC(=O)NCCCN(C)C |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | WZZLDXDUQPOXNW-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C9H20N2O2/c1-4-8-13-9(12)10-6-5-7-11(2)3/h4-8H2,1-3H3,(H,10,12) |
| Pesticide type | Fungicide |
| Substance group | Carbamate |
| Minimum active substance purity | - |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Systemic, with protective action absorbed by roots and leaves and translocated. Lipid synthesis inhibitor. |
| CAS RN | 24579-73-5 |
| EC number | - |
| CIPAC number | 399 |
| US EPA chemical code | 119302 |
| PubChem CID | 32490 |
| Molecular mass (g mol-1) | 188.3 |
| PIN (Preferred Identification Name) | propyl [3-(dimethylamino)propyl]carbamate |
| IUPAC name | propyl 3-(dimethylamino)propylcarbamate |
| CAS name | propyl (3-(dimethylamino)propyl)carbamate |