China C5h9no 3-Ethoxypropionitrile 2141-62-0 CAS No. 2141-62-0, Find details about China 3-Ethoxypropionitrile, C5h9no from C5h9no 3-Ethoxypropionitrile 2141-62-0 CAS No. 2141-62-0
| 3-ethoxypropionitrile basic information | |
| product name: | 3-ethoxypropionitrile |
| synonyms: | propanenitrile,3-ethoxy-;propionitrile, 3-ethoxy-;propionitrile,3-ethoxy-;β-ethoxypropionitrile;3-ethoxypropiononitrile;3-ethoxypropionitrile (eopn);3-ethoxypropionitride;2-cyanoethyl ethyl ether |
| cas: | 2141-62-0 |
| mf: | c5h9no |
| mw: | 99.13 |
| einecs: | 218-393-4 |
| product categories: | |
| mol file: | 2141-62-0.mol |
| 3-ethoxypropionitrile chemical properties | |
| boiling point | 171°c |
| density | 0.894 |
| refractive index | 1.4075 |
| fp | 64°c |
| brn | 741924 |
| cas database reference | 2141-62-0(cas database reference) |
| nist chemistry reference | c2h5ch(oc2h5)ch2cn(2141-62-0) |
| epa substance registry system | propanenitrile, 3-ethoxy-(2141-62-0) |
| safety information | |
| hazard codes | xi |
| risk statements | 20/21/22-36/37/38 |
| safety statements | 26-36/37/39-36-37 |
| ridadr | 3276 |
| rtecs | tz4680000 |
| tsca | yes |
| 3-ethoxypropionitrile usage and synthesis | |
| chemical properties | colorless liquid |
| 3-ethoxypropionitrile preparation products and raw materials | |
| raw materials | bromoethane |