China Fungicide Pesticide Iprobenfos 500g/L Ec, Find details about China Bactericide, Metalaxyl from Fungicide Pesticide Iprobenfos 500g/L Ec
| Isomerism | - |
| Chemical formula | C13H21O3PS |
| Canonical SMILES | CC(C)OP(=O)(OC(C)C)SCC1=CC=CC=C1 |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | FCOAHACKGGIURQ-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C13H21O3PS/c1-11(2)15-17(14,16-12(3)4)18-10-13-8-6-5-7-9-13/h5-9,11-12H,10H2,1-4H3 |
| Pesticide type | Fungicide |
| Substance group | Organophosphate |
| Minimum active substance purity | - |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Systemic, with both curative and protective properties. Absorbed through roots and translocated. Phospholipid biosynthesis inhibitor |
| CAS RN | 26087-47-8 |
| EC number | 247-449-0 |
| CIPAC number | 393 |
| US EPA chemical code | - |
| PubChem CID | 18772466 |
| Molecular mass (g mol-1) | 288.34 |
| PIN (Preferred Identification Name) | S-benzyl O,O-di(propan-2-yl) phosphorothioate |
| IUPAC name | S-benzyl O,O-diisopropyl phosphorothioate |
| CAS name | O,O-bis(1-methylethyl) S-(phenylmethyl) phosphorothioate |