Dicamba 65.5% + Triasulfuron 4.1% WG/WDG Herbicide PesticideDicambaDicamba is a selective, systemic herbicide approved for use in the EU and used for general weed control. It is highly soluble in water, volatile and has a low potential to leach to groundwater based on its chemical properties. It is not persistent in soil but, under certain conditions, it may persist in aquatic systems. It is moderately toxic to mammals but has a low potential to bioaccumulate. It is an irritant. it is moderately toxic to birds, most aquatic species, honeybees and earthworms.
Description: A herbicide for control of annual and perennial broad-leaved weeds and brush species
Example pests controlled: Bedstraw; Buttercup; Carpetwed; Cocklebur; Lambsquarters; Mallow; Goosefoot; Pigweed; Sowthistle; Velvetleaf; Knapweed; Teasel; Plantains; Bindweed; Thistles
Example applications: Corn; Cotton; Sugarcane; Soybeans; Sorghum; Asparagus; Grass seed crops; Non-cropland
Chemical structure: | Isomerism | Isomeric - also occurs as 3,5-dichloro-2-methoxybenzoic acid |
| Chemical formula | C8H6Cl2O3 |
| Canonical SMILES | COC1=C(C=CC(=C1C(=O)O)Cl)Cl |
| Isomeric SMILES | Clc1ccc(Cl)c(c1OC)C(=O)O |
| International Chemical Identifier key (InChIKey) | IWEDIXLBFLAXBO-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C8H6Cl2O3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12/h2-3H,1H3,(H,11,12) |
| Pesticide type | Herbicide |
| Substance group | Benzoic acid |
| Minimum active substance purity | 850 g/kg |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Selective, systemic, absorbed through leaves and translocates throughout plant. Synthetic auxin. |
| CAS RN | 1918-00-9 |
| EC number | 217-635-6 |
| CIPAC number | 85 |
| US EPA chemical code | 029801 |
| PubChem CID | 3030 |
| Molecular mass (g mol-1) | 221.04 |
| PIN (Preferred Identification Name) | 3,6-dichloro-2-methoxybenzoic acid |
| IUPAC name | 3,6-dichloro-o-anisic acid |
| CAS name | 3,6-dichloro-2-methoxybenzoic acid |
| Other status information | Potential groundwater contaminant |
Example pests controlled: Annual ryegrass; Paradoxa grass; Timothy; Wild radish; Deadnettles; Hedge mustard; Rough poppy; Wild turnip; Bermudagrass; Smooth brome
Example applications: Cereals including wheat, oats, barley; Non-crop areas including rangeland, roadsides, railways, industrial sites, paths, rights-of-way
Chemical structure: | Isomerism | - |
| Chemical formula | C14H16ClN5O5S |
| Canonical SMILES | CC1=NC(=NC(=N1)OC)NC(=O)NS(=O)(=O)C2=CC=CC=C2OCCCl |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | XOPFESVZMSQIKC-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C14H16ClN5O5S/c1-9-16-12(19-14(17-9)24-2)18-13(21)20-26(22,23)11-6-4-3-5-10(11)25-8-7-15/h3-6H,7-8H2,1-2H3,(H2,16,17,18,19,20,21) |
| Pesticide type | Herbicide |
| Substance group | Sulfonylurea |
| Minimum active substance purity | 940 g/kg |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Selective, absorbed by leaves and roots and translocated. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
| CAS RN | 82097-50-5 |
| EC number | - |
| CIPAC number | 480 |
| US EPA chemical code | 128969 |
| PubChem CID | 73282 |
| Molecular mass (g mol-1) | 401.8 |
| PIN (Preferred Identification Name) | 2-(2-chloroethoxy)-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]benzene-1-sulfonamide |
| IUPAC name | 1-[2-(2-chloroethoxy)phenylsulfonyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea |
| CAS name | 2-(2-chloroethoxy)-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]benzenesulfonamide |