China Niclosamide Wp Molluscicide & Nematicide (Insecticide) Pesticide (70%, 83.1%), Find details about China Molluscicide, Nematicide from Niclosamide Wp Molluscicide & Nematicide (Insecticide) Pesticide (70%, 83.1%)
| Isomerism | - |
| Chemical formula | C13H8Cl2N2O4 |
| Canonical SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NC(=O)C2=C(C=CC(=C2)Cl)O |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | RJMUSRYZPJIFPJ-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h1-6,18H,(H,16,19) |
| Pesticide type | Fungicide, Molluscide, Nematicide, Veterinary substance, Teniacide |
| Substance group | Chloronitrophenol |
| Minimum active substance purity | >96% |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Respiratory & stomach action. Acts by uncoupling oxidative phosphorylation in the tapeworm |
| CAS RN | 50-65-7 |
| EC number | 200-056-8 |
| CIPAC number | 599 |
| US EPA chemical code | - |
| PubChem CID | 4477 |
| Molecular mass (g mol-1) | 327.12 |
| PIN (Preferred Identification Name) | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| IUPAC name | 2'5-dichloro-4'-nitrosalicylanilide |
| CAS name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |