China Lufenuron Tc Insecticide Pesticide & Acaricide (96%, 97%), Find details about China Veterinary Substance, Profenofos from Lufenuron Tc Insecticide Pesticide & Acaricide (96%, 97%)
| Isomerism | Lufenuron consists of a pair of enantiomers. A chiral centre exists at the 2-position of the hexafluoropropoxy side-chain. |
| Chemical formula | C17H8Cl2F8N2O3 |
| Canonical SMILES | C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=C(C=C2Cl)OC(C(C(F)(F)F)F)(F)F)Cl)F |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | PWPJGUXAGUPAHP-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C17H8Cl2F8N2O3/c18-6-5-11(32-17(26,27)14(22)16(23,24)25)7(19)4-10(6)28-15(31)29-13(30)12-8(20)2-1-3-9(12)21/h1-5,14H,(H2,28,29,30,31) |
| Pesticide type | Insecticide, Acaricide, Veterinary substance |
| Substance group | Benzoylurea |
| Minimum active substance purity | - |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Systemic, selective, stomach acting, chitin synthesis inhibitor |
| CAS RN | 103055-07-8 |
| EC number | 410-690-9 |
| CIPAC number | 704 |
| US EPA chemical code | - |
| PubChem CID | 71777 |
| Molecular mass (g mol-1) | 511.16 |
| PIN (Preferred Identification Name) | - |
| IUPAC name | (RS)-1-[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-3-(2,6-difluorobenzoyl)urea |
| CAS name | N-(((2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl)amino)carbonyl)-2,6-difluorobenzamide |