China Insecticide Pesticide & Acaricide Propargite 570g/L Ec, Find details about China Teflubenzuron, Triazophos from Insecticide Pesticide & Acaricide Propargite 570g/L Ec
| Isomerism | A complex molecule with three chiral features. The name propargite may apply to several of the possible stereoisomers of the compound. |
| Chemical formula | C19H26O4S |
| Canonical SMILES | CC(C)(C)C1=CC=C(C=C1)OC2CCCCC2OS(=O)OCC#C |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | ZYHMJXZULPZUED-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C19H26O4S/c1-5-14-21-24(20)23-18-9-7-6-8-17(18)22-16-12-10-15(11-13-16)19(2,3)4/h1,10-13,17-18H,6-9,14H2,2-4H3 |
| Pesticide type | Acaricide |
| Substance group | Sulphite ester |
| Minimum active substance purity | 870 g/kg |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Non-systemic with contact action, inhibits oxidative phosphorylation |
| CAS RN | 2312-35-8 |
| EC number | 219-006-1 |
| CIPAC number | 216 |
| US EPA chemical code | 097601 |
| PubChem CID | 4936 |
| Molecular mass (g mol-1) | 350.47 |
| PIN (Preferred Identification Name) | - |
| IUPAC name | 2-(4-tert-butylphenoxy)cyclohexyl prop-2-ynyl sulphite |
| CAS name | 2-(4-(1,1-dimethylethyl)phenoxy)cyclohexyl 2-propynyl sulphite |