Herbicide Pesticide Clomazone 12% + Propanil 27% ECClomazoneDescription: Used for the control of broad-leaved weeds and grasses in a range of crops
Example pests controlled: Nightshade; Pigweed; Potato weed; Fathen; Hogweed; Wild radish; Staggerweed
Example applications: Cotton; Vegetables including peas, potatoes, sweet potatoes, green beans, navy beans; Curcubits; Tobacco; Rice; Oilseed rape
Chemical structure: | Isomerism | - |
| Chemical formula | C12H14ClNO2 |
| Canonical SMILES | CC1(CON(C1=O)CC2=CC=CC=C2Cl)C |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | KIEDNEWSYUYDSN-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C12H14ClNO2/c1-12(2)8-16-14(11(12)15)7-9-5-3-4-6-10(9)13/h3-6H,7-8H2,1-2H3 |
| Pesticide type | Herbicide |
| Substance group | Isoxazolidinone |
| Minimum active substance purity | 960 g/kg |
| Known relevant impurities | EU dossier - None declared |
| Substance origin | Synthetic |
| Mode of action | Selective, absorbed by roots and shoots. Inhibition of lycopene cyclase. |
| CAS RN | 81777-89-1 |
| EC number | - |
| CIPAC number | 509 |
| US EPA chemical code | 125401 |
| PubChem CID | 54778 |
| Molecular mass (g mol-1) | 239.7 |
| PIN (Preferred Identification Name) | 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-1,2-oxazolidin-3-one |
| IUPAC name | 2-(2-chlorobenzyl)-4,4-dimethyl-1,2-oxazolidin-3-one |
| CAS name | 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-3-isoxazolidinone |
Propanil is a post-emergence herbicide currently being assessed for safety and efficiacy by the EU. It is moderately soluble in water and has a low volatility. It is not expected to leach to groundwater and is not usually persistent in soil or water systems. It is moderately toxic to mammals and no evidence of serious human health impact have been identified. It is, however, moderately toxic to most fauna and flora.
Description: A post-emergence herbicide used for broad-leaved and annual grass weed control in rice and other crops
Example pests controlled: Barnyard grass; Morning glory; Crabgrass; Annual sedges; Late watergrass; Junglerice; Prickly grass
Example applications: Rice; Potatoes; Wheat
Chemical structure: | Isomerism | - |
| Chemical formula | C9H9Cl2NO |
| Canonical SMILES | CCC(=O)NC1=CC(=C(C=C1)Cl)Cl |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | LFULEKSKNZEWOE-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C9H9Cl2NO/c1-2-9(13)12-6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3,(H,12,13) |
| Pesticide type | Herbicide |
| Substance group | Anilide |
| Minimum active substance purity | >984 g/Kg |
| Known relevant impurities | EU dossier: 2,3-DCA <0.5g/kg; 3,4-DCA <2.7g/kg; TCBA <2mg/kg; TCAOB <0.9 mg/kg |
| Substance origin | Synthetic |
| Mode of action | Selective with contact action, inhibition of photosynthesis |
| CAS RN | 709-98-8 |
| EC number | 211-914-6 |
| CIPAC number | 205 |
| US EPA chemical code | 028201 |
| PubChem CID | 4933 |
| Molecular mass (g mol-1) | 218.08 |
| PIN (Preferred Identification Name) | - |
| IUPAC name | 3',4'-dichloropropionanilide |
| CAS name | N-(3,4-dichlorophenyl)propanamide |
| Other status information | Chemical subject to PIC regulations |