China Fenpropathrin 20% Ew Insecticide Pesticide & Acaricide, Find details about China Hexythiazox, Imidacloprid from Fenpropathrin 20% Ew Insecticide Pesticide & Acaricide
| Isomerism | A chiral molecule existing in the S- and R-forms. The commercial product is mixture of stereoisomers, the (S)-isomer primarily responsible for the bioactivity. |
| Chemical formula | C22H23NO3 |
| Canonical SMILES | CC1(C(C1(C)C)C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3)C |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | XQUXKZZNEFRCAW-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C22H23NO3/c1-21(2)19(22(21,3)4)20(24)26-18(14-23)15-9-8-12-17(13-15)25-16-10-6-5-7-11-16/h5-13,18-19H,1-4H3 |
| Pesticide type | Insecticide, Acaricide |
| Substance group | Pyrethroid |
| Minimum active substance purity | >90% |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Non-systemic with contact and stomach action. Sodium channel modulator. |
| CAS RN | 39515-41-8 |
| Alternative/old CAS RN | 64257-84-7 |
| EC number | 254-485-0 |
| CIPAC number | 426 |
| US EPA chemical code | 127901 |
| PubChem CID | 47326 |
| Molecular mass (g mol-1) | 349.42 |
| PIN (Preferred Identification Name) | rac-(R)-cyano(3-phenoxyphenyl)methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate |
| IUPAC name | (RS)-α-cyano-3-phenoxybenzyl 2,2,3,3-tetramethylcyclopropanecarboxylate |
| CAS name | cyano(3-phenoxyphenyl)methyl 2,2,3,3-tetramethylcyclopropanecarboxylate |
| Other status information | OSPAR soc; Severe Marine Pollutant; Chemical subject to PIC regulations |